C14H15NO3 — CID 934175
1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 934175) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 934175 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)O)c2C)cc1 |
| InChI | InChI=1S/C14H15NO3/c1-9-8-13(14(16)17)10(2)15(9)11-4-6-12(18-3)7-5-11/h4-8H,1-3H3,(H,16,17) |
| InChIKey | JPCJXGCPGGBFCU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|