C18H22N2O4S — CID 9342508
N-(2,3-dimethylphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide (PubChem CID 9342508) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 9342508 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(=O)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-4-24-15-8-10-16(11-9-15)25(22,23)19-12-18(21)20-17-7-5-6-13(2)14(17)3/h5-11,19H,4,12H2,1-3H3,(H,20,21) |
| InChIKey | QPCPBDZDLLCQHO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |