C19H17ClN2O2S — CID 9342719
(5Z)-3-(4-chloro-2-methylphenyl)-5-[(4-ethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 9342719) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is (5Z)-3-(4-chloro-2-methylphenyl)-5-[(4-ethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(4-chloro-2-methylphenyl)-5-[(4-ethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 9342719 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (5Z)-3-(4-chloro-2-methylphenyl)-5-[(4-ethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(/C=C2\NC(=S)N(c3ccc(Cl)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C19H17ClN2O2S/c1-3-24-15-7-4-13(5-8-15)11-16-18(23)22(19(25)21-16)17-9-6-14(20)10-12(17)2/h4-11H,3H2,1-2H3,(H,21,25)/b16-11- |
| InChIKey | HRFRCJSRPNQWPM-WJDWOHSUSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|