C20H20N2OS — CID 9343361
N-[2-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenyl]ethyl]acetamide (PubChem CID 9343361) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 9343361 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[2-[4-[2-(4-methylphenyl)-1,3-thiazol-4-yl]phenyl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(-c2csc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C20H20N2OS/c1-14-3-7-18(8-4-14)20-22-19(13-24-20)17-9-5-16(6-10-17)11-12-21-15(2)23/h3-10,13H,11-12H2,1-2H3,(H,21,23) |
| InChIKey | MKVWCEHWKOCPAU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |