C15H17N3OS — CID 9343622
5-[2-(butylamino)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one (PubChem CID 9343622) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 5-[2-(butylamino)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(butylamino)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 9343622 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-[2-(butylamino)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one |
| SMILES | CCCCNc1nc(-c2ccc3c(c2)CC(=O)N3)cs1 |
| InChI | InChI=1S/C15H17N3OS/c1-2-3-6-16-15-18-13(9-20-15)10-4-5-12-11(7-10)8-14(19)17-12/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | GPKJLHANLXXQCL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|