C21H24N2O5 — CID 9344257
[2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(2-nitrophenyl)acetate (PubChem CID 9344257) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(2-nitrophenyl)acetate.
| Compound Name | [2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 9344257 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(2-nitrophenyl)acetate |
| SMILES | CC(C)c1ccc(CCNC(=O)COC(=O)Cc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-15(2)17-9-7-16(8-10-17)11-12-22-20(24)14-28-21(25)13-18-5-3-4-6-19(18)23(26)27/h3-10,15H,11-14H2,1-2H3,(H,22,24) |
| InChIKey | MAGROBIHOCGSMF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|