About (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone
(1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone (PubChem CID 934511) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone |
| PubChem CID | 934511 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone |
| SMILES | CS(=O)(=O)N1CCc2cc(C(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C15H20N2O3S/c1-21(19,20)17-10-7-12-11-13(5-6-14(12)17)15(18)16-8-3-2-4-9-16/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | RLJWMGVMORCHKM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone?
The IUPAC name of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone (CID 934511) is (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone is CS(=O)(=O)N1CCc2cc(C(=O)N3CCCCC3)ccc21.
What is the InChIKey of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone?
The InChIKey is RLJWMGVMORCHKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-21(19,20)17-10-7-12-11-13(5-6-14(12)17)15(18)16-8-3-2-4-9-16/h5-6,11H,2-4,7-10H2,1H3.
What are the key properties of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone?
(1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone has a molecular weight of 308.40 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylsulfonyl-2,3-dihydroindol-5-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 934511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).