C11H14BrNO3 — CID 93454839
methyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)propanoate (PubChem CID 93454839) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)propanoate.
| Compound Name | methyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 93454839 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | methyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)propanoate |
| SMILES | COC(=O)C[C@H](N)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C11H14BrNO3/c1-15-10-4-3-7(5-8(10)12)9(13)6-11(14)16-2/h3-5,9H,6,13H2,1-2H3/t9-/m0/s1 |
| InChIKey | IYVWGBFPKXXSJG-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |