About 1-[(3R)-thiolan-3-yl]-1,4-diazepane
1-[(3R)-thiolan-3-yl]-1,4-diazepane (PubChem CID 93464550) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 1-[(3R)-thiolan-3-yl]-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[(3R)-thiolan-3-yl]-1,4-diazepane |
| PubChem CID | 93464550 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-[(3R)-thiolan-3-yl]-1,4-diazepane |
| SMILES | C1CNCCN([C@@H]2CCSC2)C1 |
| InChI | InChI=1S/C9H18N2S/c1-3-10-4-6-11(5-1)9-2-7-12-8-9/h9-10H,1-8H2/t9-/m1/s1 |
| InChIKey | GYVHYUGVFAYODF-SECBINFHSA-N |
| XLogP | 0.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3R)-thiolan-3-yl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-thiolan-3-yl]-1,4-diazepane?
The IUPAC name of 1-[(3R)-thiolan-3-yl]-1,4-diazepane (CID 93464550) is 1-[(3R)-thiolan-3-yl]-1,4-diazepane.
What is the SMILES notation for 1-[(3R)-thiolan-3-yl]-1,4-diazepane?
The canonical SMILES for 1-[(3R)-thiolan-3-yl]-1,4-diazepane is C1CNCCN([C@@H]2CCSC2)C1.
What is the InChIKey of 1-[(3R)-thiolan-3-yl]-1,4-diazepane?
The InChIKey is GYVHYUGVFAYODF-SECBINFHSA-N. The full InChI is InChI=1S/C9H18N2S/c1-3-10-4-6-11(5-1)9-2-7-12-8-9/h9-10H,1-8H2/t9-/m1/s1.
What are the key properties of 1-[(3R)-thiolan-3-yl]-1,4-diazepane?
1-[(3R)-thiolan-3-yl]-1,4-diazepane has a molecular weight of 186.32 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-thiolan-3-yl]-1,4-diazepane is sourced from PubChem (CID 93464550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).