C18H21N3O4 — CID 9346463
[2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 9346463) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9346463 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)COC(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-19(2)16-6-4-14(5-7-16)12-20(3)17(22)13-25-18(23)15-8-10-21(24)11-9-15/h4-11H,12-13H2,1-3H3 |
| InChIKey | QJMNNBGTHYQNQP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|