C24H33N3O — CID 9347122
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1R)-1-phenylbutyl]acetamide (PubChem CID 9347122) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1R)-1-phenylbutyl]acetamide.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1R)-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 9347122 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1R)-1-phenylbutyl]acetamide |
| SMILES | CCC[C@@H](NC(=O)CN1CCN(c2cccc(C)c2C)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H33N3O/c1-4-9-22(21-11-6-5-7-12-21)25-24(28)18-26-14-16-27(17-15-26)23-13-8-10-19(2)20(23)3/h5-8,10-13,22H,4,9,14-18H2,1-3H3,(H,25,28)/t22-/m1/s1 |
| InChIKey | JQTPPKWKWGDHEO-JOCHJYFZSA-N |
| XLogP | 4.08 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |