C12H11F2NO2 — CID 93478392
ethyl (2R)-4,5-difluoro-2-methyl-2H-indole-3-carboxylate (PubChem CID 93478392) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is ethyl (2R)-4,5-difluoro-2-methyl-2H-indole-3-carboxylate.
| Compound Name | ethyl (2R)-4,5-difluoro-2-methyl-2H-indole-3-carboxylate |
|---|---|
| PubChem CID | 93478392 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | ethyl (2R)-4,5-difluoro-2-methyl-2H-indole-3-carboxylate |
| SMILES | CCOC(=O)C1=c2c(F)c(F)ccc2=N[C@@H]1C |
| InChI | InChI=1S/C12H11F2NO2/c1-3-17-12(16)9-6(2)15-8-5-4-7(13)11(14)10(8)9/h4-6H,3H2,1-2H3/t6-/m1/s1 |
| InChIKey | OVZCDMBHWBRHAJ-ZCFIWIBFSA-N |
| XLogP | 0.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |