C13H19ClN4O — CID 93480988
4-chloro-6-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]pyrimidine (PubChem CID 93480988) has the molecular formula C13H19ClN4O and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-chloro-6-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 4-chloro-6-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 93480988 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-chloro-6-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-1-yl]pyrimidine |
| SMILES | Clc1cc(N2CCN(C[C@H]3CCCO3)CC2)ncn1 |
| InChI | InChI=1S/C13H19ClN4O/c14-12-8-13(16-10-15-12)18-5-3-17(4-6-18)9-11-2-1-7-19-11/h8,10-11H,1-7,9H2/t11-/m1/s1 |
| InChIKey | LWMBZLVUCKIUIU-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |