About [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate
[(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate (PubChem CID 93483987) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate.
Molecular Properties
| Compound Name | [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate |
| PubChem CID | 93483987 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@@H](OC(=O)CCC)C1 |
| InChI | InChI=1S/C14H22O2/c1-5-6-14(15)16-13-9-12(10(2)3)8-7-11(13)4/h7,12-13H,2,5-6,8-9H2,1,3-4H3/t12-,13+/m1/s1 |
| InChIKey | NFYWZJFDZXGDJZ-OLZOCXBDSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate?
The IUPAC name of [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate (CID 93483987) is [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate.
What is the SMILES notation for [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate?
The canonical SMILES for [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate is C=C(C)[C@@H]1CC=C(C)[C@@H](OC(=O)CCC)C1.
What is the InChIKey of [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate?
The InChIKey is NFYWZJFDZXGDJZ-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H22O2/c1-5-6-14(15)16-13-9-12(10(2)3)8-7-11(13)4/h7,12-13H,2,5-6,8-9H2,1,3-4H3/t12-,13+/m1/s1.
What are the key properties of [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate?
[(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate has a molecular weight of 222.33 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] butanoate is sourced from PubChem (CID 93483987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).