C24H25ClN2O3S — CID 93486433
3-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 93486433) has the molecular formula C24H25ClN2O3S and a molecular weight of 457.00 g/mol. Its IUPAC name is 3-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | 3-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 93486433 |
| Molecular Formula | C24H25ClN2O3S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 3-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | CC[C@@H](NC(=O)c1ccc(NS(=O)(=O)c2ccc(C)cc2)c(Cl)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25ClN2O3S/c1-4-22(18-9-5-16(2)6-10-18)26-24(28)19-11-14-23(21(25)15-19)27-31(29,30)20-12-7-17(3)8-13-20/h5-15,22,27H,4H2,1-3H3,(H,26,28)/t22-/m1/s1 |
| InChIKey | LOONWQKEZHTJCG-JOCHJYFZSA-N |
| XLogP | 5.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |