C24H27NO5S — CID 93486755
N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzenesulfonamide (PubChem CID 93486755) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 93486755 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzenesulfonamide |
| SMILES | CCOc1ccc([C@@H](C)NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)cc1OCC |
| InChI | InChI=1S/C24H27NO5S/c1-4-28-23-16-11-19(17-24(23)29-5-2)18(3)25-31(26,27)22-14-12-21(13-15-22)30-20-9-7-6-8-10-20/h6-18,25H,4-5H2,1-3H3/t18-/m1/s1 |
| InChIKey | MRAXKQJITHVKSU-GOSISDBHSA-N |
| XLogP | 5.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |