C21H27NO3 — CID 93487568
N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-4-(4-methoxyphenoxy)butanamide (PubChem CID 93487568) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 93487568 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-4-(4-methoxyphenoxy)butanamide |
| SMILES | COc1ccc(OCCCC(=O)N[C@H](C)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-15-7-12-20(16(2)14-15)17(3)22-21(23)6-5-13-25-19-10-8-18(24-4)9-11-19/h7-12,14,17H,5-6,13H2,1-4H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | UMMUIWQBJSNCHM-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|