C12H11N5O3S — CID 93488566
(2R)-2-(10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-4-sulfanylbutanoic acid (PubChem CID 93488566) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is (2R)-2-(10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-4-sulfanylbutanoic acid.
| Compound Name | (2R)-2-(10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 93488566 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (2R)-2-(10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)-4-sulfanylbutanoic acid |
| SMILES | O=C(O)[C@@H](CCS)n1ccc2c(cnc3ncnn32)c1=O |
| InChI | InChI=1S/C12H11N5O3S/c18-10-7-5-13-12-14-6-15-17(12)8(7)1-3-16(10)9(2-4-21)11(19)20/h1,3,5-6,9,21H,2,4H2,(H,19,20)/t9-/m1/s1 |
| InChIKey | WTLUZGMKIVMQNN-SECBINFHSA-N |
| XLogP | 0.38 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|