C8H14N2O2S2 — CID 93488674
[(Z)-[(2S,4S)-2,4-dimethyl-1,3-dithiolan-2-yl]methylideneamino] N-methylcarbamate (PubChem CID 93488674) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is [(Z)-[(2S,4S)-2,4-dimethyl-1,3-dithiolan-2-yl]methylideneamino] N-methylcarbamate.
| Compound Name | [(Z)-[(2S,4S)-2,4-dimethyl-1,3-dithiolan-2-yl]methylideneamino] N-methylcarbamate |
|---|---|
| PubChem CID | 93488674 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | [(Z)-[(2S,4S)-2,4-dimethyl-1,3-dithiolan-2-yl]methylideneamino] N-methylcarbamate |
| SMILES | CNC(=O)O/N=C\[C@@]1(C)SC[C@H](C)S1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-6-4-13-8(2,14-6)5-10-12-7(11)9-3/h5-6H,4H2,1-3H3,(H,9,11)/b10-5-/t6-,8-/m0/s1 |
| InChIKey | GHFMMRFMDHDOBP-FQSHVDOQSA-N |
| XLogP | 1.91 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|