C8H13N3O4 — CID 93489542
2-[(2S)-2,3-dihydroxypropyl]-6-ethyl-1,2,4-triazine-3,5-dione (PubChem CID 93489542) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-[(2S)-2,3-dihydroxypropyl]-6-ethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[(2S)-2,3-dihydroxypropyl]-6-ethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 93489542 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-[(2S)-2,3-dihydroxypropyl]-6-ethyl-1,2,4-triazine-3,5-dione |
| SMILES | CCc1nn(C[C@H](O)CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O4/c1-2-6-7(14)9-8(15)11(10-6)3-5(13)4-12/h5,12-13H,2-4H2,1H3,(H,9,14,15)/t5-/m0/s1 |
| InChIKey | OOWUZRLOGBFSDP-YFKPBYRVSA-N |
| XLogP | -2.15 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |