About (2S)-2-chloro-1,2-dicyclopropylethanone
(2S)-2-chloro-1,2-dicyclopropylethanone (PubChem CID 93494101) has the molecular formula C8H11ClO
and a molecular weight of 158.63 g/mol. Its IUPAC name is (2S)-2-chloro-1,2-dicyclopropylethanone.
Molecular Properties
| Compound Name | (2S)-2-chloro-1,2-dicyclopropylethanone |
| PubChem CID | 93494101 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (2S)-2-chloro-1,2-dicyclopropylethanone |
| SMILES | O=C(C1CC1)[C@@H](Cl)C1CC1 |
| InChI | InChI=1S/C8H11ClO/c9-7(5-1-2-5)8(10)6-3-4-6/h5-7H,1-4H2/t7-/m0/s1 |
| InChIKey | BXNBBHNTCOTZHJ-ZETCQYMHSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-chloro-1,2-dicyclopropylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-chloro-1,2-dicyclopropylethanone?
The IUPAC name of (2S)-2-chloro-1,2-dicyclopropylethanone (CID 93494101) is (2S)-2-chloro-1,2-dicyclopropylethanone.
What is the SMILES notation for (2S)-2-chloro-1,2-dicyclopropylethanone?
The canonical SMILES for (2S)-2-chloro-1,2-dicyclopropylethanone is O=C(C1CC1)[C@@H](Cl)C1CC1.
What is the InChIKey of (2S)-2-chloro-1,2-dicyclopropylethanone?
The InChIKey is BXNBBHNTCOTZHJ-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H11ClO/c9-7(5-1-2-5)8(10)6-3-4-6/h5-7H,1-4H2/t7-/m0/s1.
What are the key properties of (2S)-2-chloro-1,2-dicyclopropylethanone?
(2S)-2-chloro-1,2-dicyclopropylethanone has a molecular weight of 158.63 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-chloro-1,2-dicyclopropylethanone is sourced from PubChem (CID 93494101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).