About N-(4,6-dimethoxypyrimidin-2-yl)acetamide
N-(4,6-dimethoxypyrimidin-2-yl)acetamide (PubChem CID 934943) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)acetamide |
| PubChem CID | 934943 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)acetamide |
| SMILES | COc1cc(OC)nc(NC(C)=O)n1 |
| InChI | InChI=1S/C8H11N3O3/c1-5(12)9-8-10-6(13-2)4-7(11-8)14-3/h4H,1-3H3,(H,9,10,11,12) |
| InChIKey | WGASZOSYILSZAZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,6-dimethoxypyrimidin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethoxypyrimidin-2-yl)acetamide?
The IUPAC name of N-(4,6-dimethoxypyrimidin-2-yl)acetamide (CID 934943) is N-(4,6-dimethoxypyrimidin-2-yl)acetamide.
What is the SMILES notation for N-(4,6-dimethoxypyrimidin-2-yl)acetamide?
The canonical SMILES for N-(4,6-dimethoxypyrimidin-2-yl)acetamide is COc1cc(OC)nc(NC(C)=O)n1.
What is the InChIKey of N-(4,6-dimethoxypyrimidin-2-yl)acetamide?
The InChIKey is WGASZOSYILSZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-5(12)9-8-10-6(13-2)4-7(11-8)14-3/h4H,1-3H3,(H,9,10,11,12).
What are the key properties of N-(4,6-dimethoxypyrimidin-2-yl)acetamide?
N-(4,6-dimethoxypyrimidin-2-yl)acetamide has a molecular weight of 197.19 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethoxypyrimidin-2-yl)acetamide is sourced from PubChem (CID 934943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).