(2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid

C7H10N2O2 — CID 93495215

IUPAC(2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid
SMILESCC1=NC[C@@H](C(=O)O)N=C1C
InChIInChI=1S/C7H10N2O2/c1-4-5(2)9-6(3-8-4)7(10)11/h6H,3H2,1-2H3,(H,10,11)/t6-/m0/s1
InChIKeyJQJUCHCCOPTAKV-LURJTMIESA-N
MW154.17 g/mol
LogP0.38
Rot. Bonds1

About (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid

(2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid (PubChem CID 93495215) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid
PubChem CID93495215
Molecular FormulaC7H10N2O2
Molecular Weight154.17 g/mol
Exact Mass154.07
IUPAC Name(2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid
SMILESCC1=NC[C@@H](C(=O)O)N=C1C
InChIInChI=1S/C7H10N2O2/c1-4-5(2)9-6(3-8-4)7(10)11/h6H,3H2,1-2H3,(H,10,11)/t6-/m0/s1
InChIKeyJQJUCHCCOPTAKV-LURJTMIESA-N
XLogP0.38
TPSA62.02 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.17
LogP ≤ 50.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid?
The IUPAC name of (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid (CID 93495215) is (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid.
What is the SMILES notation for (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid?
The canonical SMILES for (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid is CC1=NC[C@@H](C(=O)O)N=C1C.
What is the InChIKey of (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid?
The InChIKey is JQJUCHCCOPTAKV-LURJTMIESA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-5(2)9-6(3-8-4)7(10)11/h6H,3H2,1-2H3,(H,10,11)/t6-/m0/s1.
What are the key properties of (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid?
(2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid has a molecular weight of 154.17 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5,6-dimethyl-2,3-dihydropyrazine-2-carboxylic acid is sourced from PubChem (CID 93495215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).