About (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid
(2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid (PubChem CID 93495218) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid.
Analyze (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid?
The IUPAC name of (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid (CID 93495218) is (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid.
What is the SMILES notation for (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid?
The canonical SMILES for (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid is CC1=N[C@@H](C(=O)O)C=N[C@@H]1C.
What is the InChIKey of (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid?
The InChIKey is HPGQHSJSJWLFCV-INEUFUBQSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-5(2)9-6(3-8-4)7(10)11/h3-4,6H,1-2H3,(H,10,11)/t4-,6-/m1/s1.
What are the key properties of (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid?
(2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid has a molecular weight of 154.17 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-5,6-dimethyl-2,5-dihydropyrazine-2-carboxylic acid is sourced from PubChem (CID 93495218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).