C9H12O2 — CID 93495749
(3aR,4Z,6aS)-4-ethylidene-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-5-one (PubChem CID 93495749) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (3aR,4Z,6aS)-4-ethylidene-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-5-one.
| Compound Name | (3aR,4Z,6aS)-4-ethylidene-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-5-one |
|---|---|
| PubChem CID | 93495749 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (3aR,4Z,6aS)-4-ethylidene-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-5-one |
| SMILES | C/C=C1\C(=O)C[C@@H]2OCC[C@H]12 |
| InChI | InChI=1S/C9H12O2/c1-2-6-7-3-4-11-9(7)5-8(6)10/h2,7,9H,3-5H2,1H3/b6-2-/t7-,9+/m1/s1 |
| InChIKey | WARSQMVCHHVUDW-JQOKTNPQSA-N |
| XLogP | 1.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|