C9H19NO — CID 93495959
(3S,4S)-3-(2-methylpropyl)piperidin-4-ol (PubChem CID 93495959) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (3S,4S)-3-(2-methylpropyl)piperidin-4-ol.
| Compound Name | (3S,4S)-3-(2-methylpropyl)piperidin-4-ol |
|---|---|
| PubChem CID | 93495959 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (3S,4S)-3-(2-methylpropyl)piperidin-4-ol |
| SMILES | CC(C)C[C@H]1CNCC[C@@H]1O |
| InChI | InChI=1S/C9H19NO/c1-7(2)5-8-6-10-4-3-9(8)11/h7-11H,3-6H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | XTYHBMKVPVMTNH-IUCAKERBSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |