C8H12O2 — CID 93496108
trans-(1R,3R)-2,2-dimethylcyclobutane-1,3-dicarbaldehyde (PubChem CID 93496108) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dimethylcyclobutane-1,3-dicarbaldehyde.
| Compound Name | trans-(1R,3R)-2,2-dimethylcyclobutane-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 93496108 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | trans-(1R,3R)-2,2-dimethylcyclobutane-1,3-dicarbaldehyde |
| SMILES | CC1(C)[C@H](C=O)C[C@H]1C=O |
| InChI | InChI=1S/C8H12O2/c1-8(2)6(4-9)3-7(8)5-10/h4-7H,3H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | PWBRLHFTILTWCU-BQBZGAKWSA-N |
| XLogP | 1.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|