C7H10O3 — CID 93496206
(3S,4R)-4-ethyl-5-oxooxolane-3-carbaldehyde (PubChem CID 93496206) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (3S,4R)-4-ethyl-5-oxooxolane-3-carbaldehyde.
| Compound Name | (3S,4R)-4-ethyl-5-oxooxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 93496206 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (3S,4R)-4-ethyl-5-oxooxolane-3-carbaldehyde |
| SMILES | CC[C@H]1C(=O)OC[C@H]1C=O |
| InChI | InChI=1S/C7H10O3/c1-2-6-5(3-8)4-10-7(6)9/h3,5-6H,2,4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | VRYBCPBNYDECBZ-PHDIDXHHSA-N |
| XLogP | 0.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|