About (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione
(3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione (PubChem CID 93496580) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione |
| PubChem CID | 93496580 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione |
| SMILES | C[C@@H]1NC(=O)[C@@H](CO)NC1=O |
| InChI | InChI=1S/C6H10N2O3/c1-3-5(10)8-4(2-9)6(11)7-3/h3-4,9H,2H2,1H3,(H,7,11)(H,8,10)/t3-,4+/m0/s1 |
| InChIKey | JJDWARJCLFFKRT-IUYQGCFVSA-N |
| XLogP | -2.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione?
The IUPAC name of (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione (CID 93496580) is (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione.
What is the SMILES notation for (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione?
The canonical SMILES for (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione is C[C@@H]1NC(=O)[C@@H](CO)NC1=O.
What is the InChIKey of (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione?
The InChIKey is JJDWARJCLFFKRT-IUYQGCFVSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-3-5(10)8-4(2-9)6(11)7-3/h3-4,9H,2H2,1H3,(H,7,11)(H,8,10)/t3-,4+/m0/s1.
What are the key properties of (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione?
(3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione has a molecular weight of 158.16 g/mol, XLogP of -2.02, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione is sourced from PubChem (CID 93496580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).