About (2R,5R)-pyrrolidine-2,5-dicarboxamide
(2R,5R)-pyrrolidine-2,5-dicarboxamide (PubChem CID 93496955) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is (2R,5R)-pyrrolidine-2,5-dicarboxamide.
Molecular Properties
| Compound Name | (2R,5R)-pyrrolidine-2,5-dicarboxamide |
| PubChem CID | 93496955 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (2R,5R)-pyrrolidine-2,5-dicarboxamide |
| SMILES | NC(=O)[C@H]1CC[C@H](C(N)=O)N1 |
| InChI | InChI=1S/C6H11N3O2/c7-5(10)3-1-2-4(9-3)6(8)11/h3-4,9H,1-2H2,(H2,7,10)(H2,8,11)/t3-,4-/m1/s1 |
| InChIKey | HDAFHZGMAVLQCZ-QWWZWVQMSA-N |
| XLogP | -1.92 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,5R)-pyrrolidine-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-pyrrolidine-2,5-dicarboxamide?
The IUPAC name of (2R,5R)-pyrrolidine-2,5-dicarboxamide (CID 93496955) is (2R,5R)-pyrrolidine-2,5-dicarboxamide.
What is the SMILES notation for (2R,5R)-pyrrolidine-2,5-dicarboxamide?
The canonical SMILES for (2R,5R)-pyrrolidine-2,5-dicarboxamide is NC(=O)[C@H]1CC[C@H](C(N)=O)N1.
What is the InChIKey of (2R,5R)-pyrrolidine-2,5-dicarboxamide?
The InChIKey is HDAFHZGMAVLQCZ-QWWZWVQMSA-N. The full InChI is InChI=1S/C6H11N3O2/c7-5(10)3-1-2-4(9-3)6(8)11/h3-4,9H,1-2H2,(H2,7,10)(H2,8,11)/t3-,4-/m1/s1.
What are the key properties of (2R,5R)-pyrrolidine-2,5-dicarboxamide?
(2R,5R)-pyrrolidine-2,5-dicarboxamide has a molecular weight of 157.17 g/mol, XLogP of -1.92, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-pyrrolidine-2,5-dicarboxamide is sourced from PubChem (CID 93496955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).