C8H9FO2 — CID 93497302
(1S,2R,4S)-2-fluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 93497302) has the molecular formula C8H9FO2 and a molecular weight of 156.16 g/mol. Its IUPAC name is (1S,2R,4S)-2-fluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,4S)-2-fluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 93497302 |
| Molecular Formula | C8H9FO2 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (1S,2R,4S)-2-fluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(F)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C8H9FO2/c9-8(7(10)11)4-5-1-2-6(8)3-5/h1-2,5-6H,3-4H2,(H,10,11)/t5-,6+,8+/m0/s1 |
| InChIKey | DWBDWQHKLMQZHK-SHYZEUOFSA-N |
| XLogP | 1.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|