About (2S,4R)-2,4-dihydroxypentan-3-one
(2S,4R)-2,4-dihydroxypentan-3-one (PubChem CID 93497512) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is (2S,4R)-2,4-dihydroxypentan-3-one.
Molecular Properties
| Compound Name | (2S,4R)-2,4-dihydroxypentan-3-one |
| PubChem CID | 93497512 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (2S,4R)-2,4-dihydroxypentan-3-one |
| SMILES | C[C@H](O)C(=O)[C@@H](C)O |
| InChI | InChI=1S/C5H10O3/c1-3(6)5(8)4(2)7/h3-4,6-7H,1-2H3/t3-,4+ |
| InChIKey | MFYDWPYKWOVTBO-ZXZARUISSA-N |
| XLogP | -0.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,4R)-2,4-dihydroxypentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2,4-dihydroxypentan-3-one?
The IUPAC name of (2S,4R)-2,4-dihydroxypentan-3-one (CID 93497512) is (2S,4R)-2,4-dihydroxypentan-3-one.
What is the SMILES notation for (2S,4R)-2,4-dihydroxypentan-3-one?
The canonical SMILES for (2S,4R)-2,4-dihydroxypentan-3-one is C[C@H](O)C(=O)[C@@H](C)O.
What is the InChIKey of (2S,4R)-2,4-dihydroxypentan-3-one?
The InChIKey is MFYDWPYKWOVTBO-ZXZARUISSA-N. The full InChI is InChI=1S/C5H10O3/c1-3(6)5(8)4(2)7/h3-4,6-7H,1-2H3/t3-,4+.
What are the key properties of (2S,4R)-2,4-dihydroxypentan-3-one?
(2S,4R)-2,4-dihydroxypentan-3-one has a molecular weight of 118.13 g/mol, XLogP of -0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2,4-dihydroxypentan-3-one is sourced from PubChem (CID 93497512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).