C13H17NO — CID 934977
spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclohexane] (PubChem CID 934977) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclohexane].
| Compound Name | spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 934977 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | spiro[1,4-dihydro-3,1-benzoxazine-2,1'-cyclohexane] |
| SMILES | c1ccc2c(c1)COC1(CCCCC1)N2 |
| InChI | InChI=1S/C13H17NO/c1-4-8-13(9-5-1)14-12-7-3-2-6-11(12)10-15-13/h2-3,6-7,14H,1,4-5,8-10H2 |
| InChIKey | RGGVYHFOKLHTAX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |