C16H14ClN5 — CID 934986
6-(chloromethyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 934986) has the molecular formula C16H14ClN5 and a molecular weight of 311.78 g/mol. Its IUPAC name is 6-(chloromethyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(chloromethyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 934986 |
| Molecular Formula | C16H14ClN5 |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 6-(chloromethyl)-2-N,2-N-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CCl)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C16H14ClN5/c17-11-14-19-15(18)21-16(20-14)22(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H2,18,19,20,21) |
| InChIKey | MYVHEXLYWFMBCL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|