About (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane
(2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane (PubChem CID 93499836) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane.
Analyze (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane?
The IUPAC name of (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane (CID 93499836) is (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane.
What is the SMILES notation for (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane?
The canonical SMILES for (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane is C[C@@H]1CC2(C)C[C@H](C)N1C2.
What is the InChIKey of (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane?
The InChIKey is YQZAULUECVSREH-JVHMLUBASA-N. The full InChI is InChI=1S/C9H17N/c1-7-4-9(3)5-8(2)10(7)6-9/h7-8H,4-6H2,1-3H3/t7-,8+,9?.
What are the key properties of (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane?
(2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane has a molecular weight of 139.24 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2,4,6-trimethyl-1-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 93499836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).