About (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one
(5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 93499930) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one.
Molecular Properties
| Compound Name | (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| PubChem CID | 93499930 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N2CCC[C@@H](C2)N1O |
| InChI | InChI=1S/C6H10N2O2/c9-6-7-3-1-2-5(4-7)8(6)10/h5,10H,1-4H2/t5-/m0/s1 |
| InChIKey | YGORNMQZCZZCQF-YFKPBYRVSA-N |
| XLogP | 0.28 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The IUPAC name of (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one (CID 93499930) is (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one.
What is the SMILES notation for (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The canonical SMILES for (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one is O=C1N2CCC[C@@H](C2)N1O.
What is the InChIKey of (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The InChIKey is YGORNMQZCZZCQF-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-6-7-3-1-2-5(4-7)8(6)10/h5,10H,1-4H2/t5-/m0/s1.
What are the key properties of (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
(5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one has a molecular weight of 142.16 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one is sourced from PubChem (CID 93499930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).