About N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide
N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 935059) has the molecular formula C14H11N5O
and a molecular weight of 265.28 g/mol. Its IUPAC name is N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide.
Molecular Properties
| Compound Name | N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide |
| PubChem CID | 935059 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c(-c2ccncc2)n1)c1ccccc1 |
| InChI | InChI=1S/C14H11N5O/c20-13(11-4-2-1-3-5-11)17-14-16-12(18-19-14)10-6-8-15-9-7-10/h1-9H,(H2,16,17,18,19,20) |
| InChIKey | BAQBCWWGOQNMJV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide?
The IUPAC name of N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide (CID 935059) is N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide.
What is the SMILES notation for N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide?
The canonical SMILES for N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide is O=C(Nc1n[nH]c(-c2ccncc2)n1)c1ccccc1.
What is the InChIKey of N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide?
The InChIKey is BAQBCWWGOQNMJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O/c20-13(11-4-2-1-3-5-11)17-14-16-12(18-19-14)10-6-8-15-9-7-10/h1-9H,(H2,16,17,18,19,20).
What are the key properties of N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide?
N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide has a molecular weight of 265.28 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)benzamide is sourced from PubChem (CID 935059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).