C15H14N4O4 — CID 935182
(9S)-13,14-dimethoxy-4-methyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione (PubChem CID 935182) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is (9S)-13,14-dimethoxy-4-methyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione.
| Compound Name | (9S)-13,14-dimethoxy-4-methyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione |
|---|---|
| PubChem CID | 935182 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (9S)-13,14-dimethoxy-4-methyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione |
| SMILES | COc1ccc2c(c1OC)C(=O)N1c3cn(C)nc3C(=O)N[C@H]21 |
| InChI | InChI=1S/C15H14N4O4/c1-18-6-8-11(17-18)14(20)16-13-7-4-5-9(22-2)12(23-3)10(7)15(21)19(8)13/h4-6,13H,1-3H3,(H,16,20)/t13-/m0/s1 |
| InChIKey | ZOSISIBBXAITHG-ZDUSSCGKSA-N |
| XLogP | 0.84 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |