About N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide
N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide (PubChem CID 9352285) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide |
| PubChem CID | 9352285 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide |
| SMILES | CCC(CC)=NNC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C10H17N3O2/c1-3-7(4-2)12-13-10(15)9(14)11-8-5-6-8/h8H,3-6H2,1-2H3,(H,11,14)(H,13,15) |
| InChIKey | DCCAPUZLQPBBDA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide?
The IUPAC name of N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide (CID 9352285) is N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide.
What is the SMILES notation for N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide?
The canonical SMILES for N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide is CCC(CC)=NNC(=O)C(=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide?
The InChIKey is DCCAPUZLQPBBDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-3-7(4-2)12-13-10(15)9(14)11-8-5-6-8/h8H,3-6H2,1-2H3,(H,11,14)(H,13,15).
What are the key properties of N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide?
N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide has a molecular weight of 211.26 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-(pentan-3-ylideneamino)oxamide is sourced from PubChem (CID 9352285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).