About ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate
ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate (PubChem CID 935252) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate |
| PubChem CID | 935252 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccccc1C(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-4-23-18(22)20-16-8-6-5-7-15(16)17(21)19-14-10-12(2)9-13(3)11-14/h5-11H,4H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | GVMYBYCRQPWGAZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate?
The IUPAC name of ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate (CID 935252) is ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate.
What is the SMILES notation for ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate?
The canonical SMILES for ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate is CCOC(=O)Nc1ccccc1C(=O)Nc1cc(C)cc(C)c1.
What is the InChIKey of ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate?
The InChIKey is GVMYBYCRQPWGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3/c1-4-23-18(22)20-16-8-6-5-7-15(16)17(21)19-14-10-12(2)9-13(3)11-14/h5-11H,4H2,1-3H3,(H,19,21)(H,20,22).
What are the key properties of ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate?
ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate has a molecular weight of 312.37 g/mol, XLogP of 4.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-[(3,5-dimethylphenyl)carbamoyl]phenyl]carbamate is sourced from PubChem (CID 935252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).