About (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine
(Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine (PubChem CID 9353782) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine.
Molecular Properties
| Compound Name | (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine |
| PubChem CID | 9353782 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine |
| SMILES | COc1ccccc1/C=N\OCc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C16H14N2O4/c1-19-14-6-3-2-5-12(14)10-17-21-11-13-9-16(22-18-13)15-7-4-8-20-15/h2-10H,11H2,1H3/b17-10- |
| InChIKey | PXNFPUDTAZLUPQ-YVLHZVERSA-N |
| XLogP | 3.49 |
| TPSA | 69.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine?
The IUPAC name of (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine (CID 9353782) is (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine.
What is the SMILES notation for (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine?
The canonical SMILES for (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine is COc1ccccc1/C=N\OCc1cc(-c2ccco2)on1.
What is the InChIKey of (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine?
The InChIKey is PXNFPUDTAZLUPQ-YVLHZVERSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-19-14-6-3-2-5-12(14)10-17-21-11-13-9-16(22-18-13)15-7-4-8-20-15/h2-10H,11H2,1H3/b17-10-.
What are the key properties of (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine?
(Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine has a molecular weight of 298.30 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]-1-(2-methoxyphenyl)methanimine is sourced from PubChem (CID 9353782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).