C13H11FN4OS — CID 9355630
2-[(3-fluoro-4-methoxyphenyl)methyl]-5-thiophen-2-yltetrazole (PubChem CID 9355630) has the molecular formula C13H11FN4OS and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methoxyphenyl)methyl]-5-thiophen-2-yltetrazole.
| Compound Name | 2-[(3-fluoro-4-methoxyphenyl)methyl]-5-thiophen-2-yltetrazole |
|---|---|
| PubChem CID | 9355630 |
| Molecular Formula | C13H11FN4OS |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-[(3-fluoro-4-methoxyphenyl)methyl]-5-thiophen-2-yltetrazole |
| SMILES | COc1ccc(Cn2nnc(-c3cccs3)n2)cc1F |
| InChI | InChI=1S/C13H11FN4OS/c1-19-11-5-4-9(7-10(11)14)8-18-16-13(15-17-18)12-3-2-6-20-12/h2-7H,8H2,1H3 |
| InChIKey | DBTADDWTQINMDQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |