About 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione
3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 935597) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione.
Molecular Properties
| Compound Name | 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| PubChem CID | 935597 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2/c17-12-14(9-5-2-6-10-14)15-13(18)16(12)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,18) |
| InChIKey | IWJCNJMQZPEXHF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The IUPAC name of 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione (CID 935597) is 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione.
What is the SMILES notation for 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The canonical SMILES for 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione is O=C1NC2(CCCCC2)C(=O)N1c1ccccc1.
What is the InChIKey of 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione?
The InChIKey is IWJCNJMQZPEXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c17-12-14(9-5-2-6-10-14)15-13(18)16(12)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,18).
What are the key properties of 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione?
3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione has a molecular weight of 244.29 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione is sourced from PubChem (CID 935597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).