About (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate
(2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate (PubChem CID 935646) has the molecular formula C16H12ClN3O2
and a molecular weight of 313.74 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate |
| PubChem CID | 935646 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate |
| SMILES | O=C(OCc1ccccc1Cl)c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C16H12ClN3O2/c17-15-4-2-1-3-13(15)9-22-16(21)12-5-7-14(8-6-12)20-10-18-19-11-20/h1-8,10-11H,9H2 |
| InChIKey | VRGZLWZWXQOUNN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate?
The IUPAC name of (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate (CID 935646) is (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate.
What is the SMILES notation for (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate?
The canonical SMILES for (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate is O=C(OCc1ccccc1Cl)c1ccc(-n2cnnc2)cc1.
What is the InChIKey of (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate?
The InChIKey is VRGZLWZWXQOUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN3O2/c17-15-4-2-1-3-13(15)9-22-16(21)12-5-7-14(8-6-12)20-10-18-19-11-20/h1-8,10-11H,9H2.
What are the key properties of (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate?
(2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate has a molecular weight of 313.74 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl 4-(1,2,4-triazol-4-yl)benzoate is sourced from PubChem (CID 935646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).