About potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate
potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 9357) has the molecular formula C4H4KNaO6
and a molecular weight of 210.16 g/mol. Its IUPAC name is potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate.
Molecular Properties
| Compound Name | potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate |
| PubChem CID | 9357 |
| Molecular Formula | C4H4KNaO6 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-].[K+].[Na+] |
| InChI | InChI=1S/C4H6O6.K.Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
| InChIKey | LJCNRYVRMXRIQR-OLXYHTOASA-L |
| XLogP | -10.78 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | -10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate?
The IUPAC name of potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate (CID 9357) is potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate.
What is the SMILES notation for potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate?
The canonical SMILES for potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate is O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-].[K+].[Na+].
What is the InChIKey of potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate?
The InChIKey is LJCNRYVRMXRIQR-OLXYHTOASA-L. The full InChI is InChI=1S/C4H6O6.K.Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1.
What are the key properties of potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate?
potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate has a molecular weight of 210.16 g/mol, XLogP of -10.78, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;sodium;(2R,3R)-2,3-dihydroxybutanedioate is sourced from PubChem (CID 9357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).