C8H9N5S2 — CID 9358805
3-methyl-4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9358805) has the molecular formula C8H9N5S2 and a molecular weight of 239.33 g/mol. Its IUPAC name is 3-methyl-4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-methyl-4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9358805 |
| Molecular Formula | C8H9N5S2 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-methyl-4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nc(/C=N\n2c(C)n[nH]c2=S)cs1 |
| InChI | InChI=1S/C8H9N5S2/c1-5-11-12-8(14)13(5)9-3-7-4-15-6(2)10-7/h3-4H,1-2H3,(H,12,14)/b9-3- |
| InChIKey | NVQJJJZPNMLKTK-OQFOIZHKSA-N |
| XLogP | 1.90 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|