C16H18N6S3 — CID 9358898
3-methyl-4-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9358898) has the molecular formula C16H18N6S3 and a molecular weight of 390.56 g/mol. Its IUPAC name is 3-methyl-4-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-methyl-4-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9358898 |
| Molecular Formula | C16H18N6S3 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 3-methyl-4-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1/N=C\c1sc(N2CCCCC2)nc1-c1cccs1 |
| InChI | InChI=1S/C16H18N6S3/c1-11-19-20-15(23)22(11)17-10-13-14(12-6-5-9-24-12)18-16(25-13)21-7-3-2-4-8-21/h5-6,9-10H,2-4,7-8H2,1H3,(H,20,23)/b17-10- |
| InChIKey | JCPIMYSBLBEINM-YVLHZVERSA-N |
| XLogP | 4.31 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|