C18H14F3N5O2 — CID 9360157
N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 9360157) has the molecular formula C18H14F3N5O2 and a molecular weight of 389.34 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 9360157 |
| Molecular Formula | C18H14F3N5O2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H14F3N5O2/c1-25(8-15(27)24-14-7-6-13(19)16(20)17(14)21)18(28)11-2-4-12(5-3-11)26-10-22-9-23-26/h2-7,9-10H,8H2,1H3,(H,24,27) |
| InChIKey | FVFAETWDJMVNTD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|