C13H12N4O5S — CID 9361749
N'-acetyl-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetohydrazide (PubChem CID 9361749) has the molecular formula C13H12N4O5S and a molecular weight of 336.33 g/mol. Its IUPAC name is N'-acetyl-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 9361749 |
| Molecular Formula | C13H12N4O5S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N'-acetyl-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1nnc(-c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C13H12N4O5S/c1-7(18)14-15-11(19)5-23-13-17-16-12(22-13)8-2-3-9-10(4-8)21-6-20-9/h2-4H,5-6H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | IXXNAFQHUZWUFE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|