C22H24N2O4S — CID 9362151
2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(2,3,4,5-tetramethylphenyl)ethanone (PubChem CID 9362151) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(2,3,4,5-tetramethylphenyl)ethanone.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(2,3,4,5-tetramethylphenyl)ethanone |
|---|---|
| PubChem CID | 9362151 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(2,3,4,5-tetramethylphenyl)ethanone |
| SMILES | COc1ccc(-c2nnc(SCC(=O)c3cc(C)c(C)c(C)c3C)o2)cc1OC |
| InChI | InChI=1S/C22H24N2O4S/c1-12-9-17(15(4)14(3)13(12)2)18(25)11-29-22-24-23-21(28-22)16-7-8-19(26-5)20(10-16)27-6/h7-10H,11H2,1-6H3 |
| InChIKey | IBQPWOJOJWIMKR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |